C21H31NO4S — CID 119135340
2-[1-[2-[3-(tert-butylsulfinylmethyl)anilino]-2-oxoethyl]cyclohexyl]acetic acid (PubChem CID 119135340) has the molecular formula C21H31NO4S and a molecular weight of 393.55 g/mol. Its IUPAC name is 2-[1-[2-[3-(tert-butylsulfinylmethyl)anilino]-2-oxoethyl]cyclohexyl]acetic acid.
| Compound Name | 2-[1-[2-[3-(tert-butylsulfinylmethyl)anilino]-2-oxoethyl]cyclohexyl]acetic acid |
|---|---|
| PubChem CID | 119135340 |
| Molecular Formula | C21H31NO4S |
| Molecular Weight | 393.55 g/mol |
| Exact Mass | 393.20 |
| IUPAC Name | 2-[1-[2-[3-(tert-butylsulfinylmethyl)anilino]-2-oxoethyl]cyclohexyl]acetic acid |
| SMILES | CC(C)(C)S(=O)Cc1cccc(NC(=O)CC2(CC(=O)O)CCCCC2)c1 |
| InChI | InChI=1S/C21H31NO4S/c1-20(2,3)27(26)15-16-8-7-9-17(12-16)22-18(23)13-21(14-19(24)25)10-5-4-6-11-21/h7-9,12H,4-6,10-11,13-15H2,1-3H3,(H,22,23)(H,24,25) |
| InChIKey | MVSXMGBTNYITCE-UHFFFAOYSA-N |
| XLogP | 4.49 |
| TPSA | 83.47 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 393.55 |
| LogP ≤ 5 | 4.49 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |