C20H27ClN2O2S — CID 120610897
3-(2-aminophenyl)-N-[3-(tert-butylsulfinylmethyl)phenyl]propanamide;hydrochloride (PubChem CID 120610897) has the molecular formula C20H27ClN2O2S and a molecular weight of 394.97 g/mol. Its IUPAC name is 3-(2-aminophenyl)-N-[3-(tert-butylsulfinylmethyl)phenyl]propanamide;hydrochloride.
| Compound Name | 3-(2-aminophenyl)-N-[3-(tert-butylsulfinylmethyl)phenyl]propanamide;hydrochloride |
|---|---|
| PubChem CID | 120610897 |
| Molecular Formula | C20H27ClN2O2S |
| Molecular Weight | 394.97 g/mol |
| Exact Mass | 394.15 |
| IUPAC Name | 3-(2-aminophenyl)-N-[3-(tert-butylsulfinylmethyl)phenyl]propanamide;hydrochloride |
| SMILES | CC(C)(C)S(=O)Cc1cccc(NC(=O)CCc2ccccc2N)c1.Cl |
| InChI | InChI=1S/C20H26N2O2S.ClH/c1-20(2,3)25(24)14-15-7-6-9-17(13-15)22-19(23)12-11-16-8-4-5-10-18(16)21;/h4-10,13H,11-12,14,21H2,1-3H3,(H,22,23);1H |
| InChIKey | WCCQKZQWCBOMNP-UHFFFAOYSA-N |
| XLogP | 4.31 |
| TPSA | 72.19 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 394.97 |
| LogP ≤ 5 | 4.31 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|