C20H25N3O2 — CID 119745433
N-[3-[[[2-(4-aminophenyl)acetyl]amino]methyl]phenyl]-3-methylbutanamide (PubChem CID 119745433) has the molecular formula C20H25N3O2 and a molecular weight of 339.44 g/mol. Its IUPAC name is N-[3-[[[2-(4-aminophenyl)acetyl]amino]methyl]phenyl]-3-methylbutanamide.
| Compound Name | N-[3-[[[2-(4-aminophenyl)acetyl]amino]methyl]phenyl]-3-methylbutanamide |
|---|---|
| PubChem CID | 119745433 |
| Molecular Formula | C20H25N3O2 |
| Molecular Weight | 339.44 g/mol |
| Exact Mass | 339.19 |
| IUPAC Name | N-[3-[[[2-(4-aminophenyl)acetyl]amino]methyl]phenyl]-3-methylbutanamide |
| SMILES | CC(C)CC(=O)Nc1cccc(CNC(=O)Cc2ccc(N)cc2)c1 |
| InChI | InChI=1S/C20H25N3O2/c1-14(2)10-20(25)23-18-5-3-4-16(11-18)13-22-19(24)12-15-6-8-17(21)9-7-15/h3-9,11,14H,10,12-13,21H2,1-2H3,(H,22,24)(H,23,25) |
| InChIKey | MWAJSPFRCJUROS-UHFFFAOYSA-N |
| XLogP | 3.11 |
| TPSA | 84.22 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 339.44 |
| LogP ≤ 5 | 3.11 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'anil_no_alk(40)', 'substructure': 'N/A'}, {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|