C19H22N4O4 — CID 48505013
4-amino-N-[[3-(3-methylbutanoylamino)phenyl]methyl]-3-nitrobenzamide (PubChem CID 48505013) has the molecular formula C19H22N4O4 and a molecular weight of 370.41 g/mol. Its IUPAC name is 4-amino-N-[[3-(3-methylbutanoylamino)phenyl]methyl]-3-nitrobenzamide.
| Compound Name | 4-amino-N-[[3-(3-methylbutanoylamino)phenyl]methyl]-3-nitrobenzamide |
|---|---|
| PubChem CID | 48505013 |
| Molecular Formula | C19H22N4O4 |
| Molecular Weight | 370.41 g/mol |
| Exact Mass | 370.16 |
| IUPAC Name | 4-amino-N-[[3-(3-methylbutanoylamino)phenyl]methyl]-3-nitrobenzamide |
| SMILES | CC(C)CC(=O)Nc1cccc(CNC(=O)c2ccc(N)c([N+](=O)[O-])c2)c1 |
| InChI | InChI=1S/C19H22N4O4/c1-12(2)8-18(24)22-15-5-3-4-13(9-15)11-21-19(25)14-6-7-16(20)17(10-14)23(26)27/h3-7,9-10,12H,8,11,20H2,1-2H3,(H,21,25)(H,22,24) |
| InChIKey | QYTIOKFGJDUYRH-UHFFFAOYSA-N |
| XLogP | 3.09 |
| TPSA | 127.36 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 370.41 |
| LogP ≤ 5 | 3.09 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|