C15H20N4O6 — CID 120694578
(2S)-2-[[2-[(4-amino-3-nitrobenzoyl)amino]acetyl]amino]-4-methylpentanoic acid (PubChem CID 120694578) has the molecular formula C15H20N4O6 and a molecular weight of 352.35 g/mol. Its IUPAC name is (2S)-2-[[2-[(4-amino-3-nitrobenzoyl)amino]acetyl]amino]-4-methylpentanoic acid.
| Compound Name | (2S)-2-[[2-[(4-amino-3-nitrobenzoyl)amino]acetyl]amino]-4-methylpentanoic acid |
|---|---|
| PubChem CID | 120694578 |
| Molecular Formula | C15H20N4O6 |
| Molecular Weight | 352.35 g/mol |
| Exact Mass | 352.14 |
| IUPAC Name | (2S)-2-[[2-[(4-amino-3-nitrobenzoyl)amino]acetyl]amino]-4-methylpentanoic acid |
| SMILES | CC(C)C[C@H](NC(=O)CNC(=O)c1ccc(N)c([N+](=O)[O-])c1)C(=O)O |
| InChI | InChI=1S/C15H20N4O6/c1-8(2)5-11(15(22)23)18-13(20)7-17-14(21)9-3-4-10(16)12(6-9)19(24)25/h3-4,6,8,11H,5,7,16H2,1-2H3,(H,17,21)(H,18,20)(H,22,23)/t11-/m0/s1 |
| InChIKey | FLNAWTYAODNWTN-NSHDSACASA-N |
| XLogP | 0.52 |
| TPSA | 164.66 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 352.35 |
| LogP ≤ 5 | 0.52 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|