C17H24N4O5 — CID 120695148
(2S)-2-[[2-[[4-[(carbamoylamino)methyl]benzoyl]amino]acetyl]amino]-4-methylpentanoic acid (PubChem CID 120695148) has the molecular formula C17H24N4O5 and a molecular weight of 364.40 g/mol. Its IUPAC name is (2S)-2-[[2-[[4-[(carbamoylamino)methyl]benzoyl]amino]acetyl]amino]-4-methylpentanoic acid.
| Compound Name | (2S)-2-[[2-[[4-[(carbamoylamino)methyl]benzoyl]amino]acetyl]amino]-4-methylpentanoic acid |
|---|---|
| PubChem CID | 120695148 |
| Molecular Formula | C17H24N4O5 |
| Molecular Weight | 364.40 g/mol |
| Exact Mass | 364.17 |
| IUPAC Name | (2S)-2-[[2-[[4-[(carbamoylamino)methyl]benzoyl]amino]acetyl]amino]-4-methylpentanoic acid |
| SMILES | CC(C)C[C@H](NC(=O)CNC(=O)c1ccc(CNC(N)=O)cc1)C(=O)O |
| InChI | InChI=1S/C17H24N4O5/c1-10(2)7-13(16(24)25)21-14(22)9-19-15(23)12-5-3-11(4-6-12)8-20-17(18)26/h3-6,10,13H,7-9H2,1-2H3,(H,19,23)(H,21,22)(H,24,25)(H3,18,20,26)/t13-/m0/s1 |
| InChIKey | HDEHQJGSNZJZAU-ZDUSSCGKSA-N |
| XLogP | 0.20 |
| TPSA | 150.62 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 364.40 |
| LogP ≤ 5 | 0.20 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 4 |