C16H21ClN2O5 — CID 120694598
(2S)-2-[[2-[(4-chloro-3-methoxybenzoyl)amino]acetyl]amino]-4-methylpentanoic acid (PubChem CID 120694598) has the molecular formula C16H21ClN2O5 and a molecular weight of 356.81 g/mol. Its IUPAC name is (2S)-2-[[2-[(4-chloro-3-methoxybenzoyl)amino]acetyl]amino]-4-methylpentanoic acid.
| Compound Name | (2S)-2-[[2-[(4-chloro-3-methoxybenzoyl)amino]acetyl]amino]-4-methylpentanoic acid |
|---|---|
| PubChem CID | 120694598 |
| Molecular Formula | C16H21ClN2O5 |
| Molecular Weight | 356.81 g/mol |
| Exact Mass | 356.11 |
| IUPAC Name | (2S)-2-[[2-[(4-chloro-3-methoxybenzoyl)amino]acetyl]amino]-4-methylpentanoic acid |
| SMILES | COc1cc(C(=O)NCC(=O)N[C@@H](CC(C)C)C(=O)O)ccc1Cl |
| InChI | InChI=1S/C16H21ClN2O5/c1-9(2)6-12(16(22)23)19-14(20)8-18-15(21)10-4-5-11(17)13(7-10)24-3/h4-5,7,9,12H,6,8H2,1-3H3,(H,18,21)(H,19,20)(H,22,23)/t12-/m0/s1 |
| InChIKey | RJBIQFKUZOFUQR-LBPRGKRZSA-N |
| XLogP | 1.69 |
| TPSA | 104.73 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 356.81 |
| LogP ≤ 5 | 1.69 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |