C16H21N3O7 — CID 120695276
(2S)-2-[[2-[(2-methoxy-5-nitrobenzoyl)amino]acetyl]amino]-4-methylpentanoic acid (PubChem CID 120695276) has the molecular formula C16H21N3O7 and a molecular weight of 367.36 g/mol. Its IUPAC name is (2S)-2-[[2-[(2-methoxy-5-nitrobenzoyl)amino]acetyl]amino]-4-methylpentanoic acid.
| Compound Name | (2S)-2-[[2-[(2-methoxy-5-nitrobenzoyl)amino]acetyl]amino]-4-methylpentanoic acid |
|---|---|
| PubChem CID | 120695276 |
| Molecular Formula | C16H21N3O7 |
| Molecular Weight | 367.36 g/mol |
| Exact Mass | 367.14 |
| IUPAC Name | (2S)-2-[[2-[(2-methoxy-5-nitrobenzoyl)amino]acetyl]amino]-4-methylpentanoic acid |
| SMILES | COc1ccc([N+](=O)[O-])cc1C(=O)NCC(=O)N[C@@H](CC(C)C)C(=O)O |
| InChI | InChI=1S/C16H21N3O7/c1-9(2)6-12(16(22)23)18-14(20)8-17-15(21)11-7-10(19(24)25)4-5-13(11)26-3/h4-5,7,9,12H,6,8H2,1-3H3,(H,17,21)(H,18,20)(H,22,23)/t12-/m0/s1 |
| InChIKey | PZCLJAFKYSHWMT-LBPRGKRZSA-N |
| XLogP | 0.95 |
| TPSA | 147.87 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 367.36 |
| LogP ≤ 5 | 0.95 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|