C17H23N3O6 — CID 120694616
(2S)-2-[[2-[(4-ethyl-3-nitrobenzoyl)amino]acetyl]amino]-4-methylpentanoic acid (PubChem CID 120694616) has the molecular formula C17H23N3O6 and a molecular weight of 365.39 g/mol. Its IUPAC name is (2S)-2-[[2-[(4-ethyl-3-nitrobenzoyl)amino]acetyl]amino]-4-methylpentanoic acid.
| Compound Name | (2S)-2-[[2-[(4-ethyl-3-nitrobenzoyl)amino]acetyl]amino]-4-methylpentanoic acid |
|---|---|
| PubChem CID | 120694616 |
| Molecular Formula | C17H23N3O6 |
| Molecular Weight | 365.39 g/mol |
| Exact Mass | 365.16 |
| IUPAC Name | (2S)-2-[[2-[(4-ethyl-3-nitrobenzoyl)amino]acetyl]amino]-4-methylpentanoic acid |
| SMILES | CCc1ccc(C(=O)NCC(=O)N[C@@H](CC(C)C)C(=O)O)cc1[N+](=O)[O-] |
| InChI | InChI=1S/C17H23N3O6/c1-4-11-5-6-12(8-14(11)20(25)26)16(22)18-9-15(21)19-13(17(23)24)7-10(2)3/h5-6,8,10,13H,4,7,9H2,1-3H3,(H,18,22)(H,19,21)(H,23,24)/t13-/m0/s1 |
| InChIKey | NKPWVYMBLIJFDE-ZDUSSCGKSA-N |
| XLogP | 1.50 |
| TPSA | 138.64 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 365.39 |
| LogP ≤ 5 | 1.50 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|