C18H20N4O4 — CID 55849464
4-amino-N-[[4-(butanoylamino)phenyl]methyl]-3-nitrobenzamide (PubChem CID 55849464) has the molecular formula C18H20N4O4 and a molecular weight of 356.38 g/mol. Its IUPAC name is 4-amino-N-[[4-(butanoylamino)phenyl]methyl]-3-nitrobenzamide.
| Compound Name | 4-amino-N-[[4-(butanoylamino)phenyl]methyl]-3-nitrobenzamide |
|---|---|
| PubChem CID | 55849464 |
| Molecular Formula | C18H20N4O4 |
| Molecular Weight | 356.38 g/mol |
| Exact Mass | 356.15 |
| IUPAC Name | 4-amino-N-[[4-(butanoylamino)phenyl]methyl]-3-nitrobenzamide |
| SMILES | CCCC(=O)Nc1ccc(CNC(=O)c2ccc(N)c([N+](=O)[O-])c2)cc1 |
| InChI | InChI=1S/C18H20N4O4/c1-2-3-17(23)21-14-7-4-12(5-8-14)11-20-18(24)13-6-9-15(19)16(10-13)22(25)26/h4-10H,2-3,11,19H2,1H3,(H,20,24)(H,21,23) |
| InChIKey | GKMPHSNZSMSXSE-UHFFFAOYSA-N |
| XLogP | 2.85 |
| TPSA | 127.36 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 356.38 |
| LogP ≤ 5 | 2.85 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|