C19H21N5O5 — CID 46558439
4-amino-N-[3-(4-carbamoylanilino)-3-oxopropyl]-N-ethyl-3-nitrobenzamide (PubChem CID 46558439) has the molecular formula C19H21N5O5 and a molecular weight of 399.41 g/mol. Its IUPAC name is 4-amino-N-[3-(4-carbamoylanilino)-3-oxopropyl]-N-ethyl-3-nitrobenzamide.
| Compound Name | 4-amino-N-[3-(4-carbamoylanilino)-3-oxopropyl]-N-ethyl-3-nitrobenzamide |
|---|---|
| PubChem CID | 46558439 |
| Molecular Formula | C19H21N5O5 |
| Molecular Weight | 399.41 g/mol |
| Exact Mass | 399.15 |
| IUPAC Name | 4-amino-N-[3-(4-carbamoylanilino)-3-oxopropyl]-N-ethyl-3-nitrobenzamide |
| SMILES | CCN(CCC(=O)Nc1ccc(C(N)=O)cc1)C(=O)c1ccc(N)c([N+](=O)[O-])c1 |
| InChI | InChI=1S/C19H21N5O5/c1-2-23(19(27)13-5-8-15(20)16(11-13)24(28)29)10-9-17(25)22-14-6-3-12(4-7-14)18(21)26/h3-8,11H,2,9-10,20H2,1H3,(H2,21,26)(H,22,25) |
| InChIKey | JBUBSFLNLQEVLI-UHFFFAOYSA-N |
| XLogP | 1.77 |
| TPSA | 161.66 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 399.41 |
| LogP ≤ 5 | 1.77 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|