C22H26N4O4 — CID 24670472
4-(acetamidomethyl)-N-[3-(4-carbamoylanilino)-3-oxopropyl]-N-ethylbenzamide (PubChem CID 24670472) has the molecular formula C22H26N4O4 and a molecular weight of 410.47 g/mol. Its IUPAC name is 4-(acetamidomethyl)-N-[3-(4-carbamoylanilino)-3-oxopropyl]-N-ethylbenzamide.
| Compound Name | 4-(acetamidomethyl)-N-[3-(4-carbamoylanilino)-3-oxopropyl]-N-ethylbenzamide |
|---|---|
| PubChem CID | 24670472 |
| Molecular Formula | C22H26N4O4 |
| Molecular Weight | 410.47 g/mol |
| Exact Mass | 410.20 |
| IUPAC Name | 4-(acetamidomethyl)-N-[3-(4-carbamoylanilino)-3-oxopropyl]-N-ethylbenzamide |
| SMILES | CCN(CCC(=O)Nc1ccc(C(N)=O)cc1)C(=O)c1ccc(CNC(C)=O)cc1 |
| InChI | InChI=1S/C22H26N4O4/c1-3-26(22(30)18-6-4-16(5-7-18)14-24-15(2)27)13-12-20(28)25-19-10-8-17(9-11-19)21(23)29/h4-11H,3,12-14H2,1-2H3,(H2,23,29)(H,24,27)(H,25,28) |
| InChIKey | RRYRFBDGFNTASS-UHFFFAOYSA-N |
| XLogP | 1.91 |
| TPSA | 121.60 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 410.47 |
| LogP ≤ 5 | 1.91 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |