C22H30N4O — CID 111244021
3-methyl-N-[3-[[[N'-methyl-N-[(4-methylphenyl)methyl]carbamimidoyl]amino]methyl]phenyl]butanamide (PubChem CID 111244021) has the molecular formula C22H30N4O and a molecular weight of 366.51 g/mol. Its IUPAC name is 3-methyl-N-[3-[[[N'-methyl-N-[(4-methylphenyl)methyl]carbamimidoyl]amino]methyl]phenyl]butanamide.
| Compound Name | 3-methyl-N-[3-[[[N'-methyl-N-[(4-methylphenyl)methyl]carbamimidoyl]amino]methyl]phenyl]butanamide |
|---|---|
| PubChem CID | 111244021 |
| Molecular Formula | C22H30N4O |
| Molecular Weight | 366.51 g/mol |
| Exact Mass | 366.24 |
| IUPAC Name | 3-methyl-N-[3-[[[N'-methyl-N-[(4-methylphenyl)methyl]carbamimidoyl]amino]methyl]phenyl]butanamide |
| SMILES | C/N=C(\NCc1ccc(C)cc1)NCc1cccc(NC(=O)CC(C)C)c1 |
| InChI | InChI=1S/C22H30N4O/c1-16(2)12-21(27)26-20-7-5-6-19(13-20)15-25-22(23-4)24-14-18-10-8-17(3)9-11-18/h5-11,13,16H,12,14-15H2,1-4H3,(H,26,27)(H2,23,24,25) |
| InChIKey | TZZBZLSNOPSARV-UHFFFAOYSA-N |
| XLogP | 3.84 |
| TPSA | 65.52 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 366.51 |
| LogP ≤ 5 | 3.84 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|