C22H29FN4O — CID 111361887
N-[3-[[[N-[2-(2-fluorophenyl)ethyl]-N'-methylcarbamimidoyl]amino]methyl]phenyl]-3-methylbutanamide (PubChem CID 111361887) has the molecular formula C22H29FN4O and a molecular weight of 384.50 g/mol. Its IUPAC name is N-[3-[[[N-[2-(2-fluorophenyl)ethyl]-N'-methylcarbamimidoyl]amino]methyl]phenyl]-3-methylbutanamide.
| Compound Name | N-[3-[[[N-[2-(2-fluorophenyl)ethyl]-N'-methylcarbamimidoyl]amino]methyl]phenyl]-3-methylbutanamide |
|---|---|
| PubChem CID | 111361887 |
| Molecular Formula | C22H29FN4O |
| Molecular Weight | 384.50 g/mol |
| Exact Mass | 384.23 |
| IUPAC Name | N-[3-[[[N-[2-(2-fluorophenyl)ethyl]-N'-methylcarbamimidoyl]amino]methyl]phenyl]-3-methylbutanamide |
| SMILES | C/N=C(\NCCc1ccccc1F)NCc1cccc(NC(=O)CC(C)C)c1 |
| InChI | InChI=1S/C22H29FN4O/c1-16(2)13-21(28)27-19-9-6-7-17(14-19)15-26-22(24-3)25-12-11-18-8-4-5-10-20(18)23/h4-10,14,16H,11-13,15H2,1-3H3,(H,27,28)(H2,24,25,26) |
| InChIKey | FWTDTUXVFIDNBK-UHFFFAOYSA-N |
| XLogP | 3.72 |
| TPSA | 65.52 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 384.50 |
| LogP ≤ 5 | 3.72 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|