C19H29N3OS — CID 167956428
N-[(2-tert-butyl-1H-imidazol-5-yl)methyl]-3-(tert-butylsulfinylmethyl)aniline (PubChem CID 167956428) has the molecular formula C19H29N3OS and a molecular weight of 347.53 g/mol. Its IUPAC name is N-[(2-tert-butyl-1H-imidazol-5-yl)methyl]-3-(tert-butylsulfinylmethyl)aniline.
| Compound Name | N-[(2-tert-butyl-1H-imidazol-5-yl)methyl]-3-(tert-butylsulfinylmethyl)aniline |
|---|---|
| PubChem CID | 167956428 |
| Molecular Formula | C19H29N3OS |
| Molecular Weight | 347.53 g/mol |
| Exact Mass | 347.20 |
| IUPAC Name | N-[(2-tert-butyl-1H-imidazol-5-yl)methyl]-3-(tert-butylsulfinylmethyl)aniline |
| SMILES | CC(C)(C)c1ncc(CNc2cccc(CS(=O)C(C)(C)C)c2)[nH]1 |
| InChI | InChI=1S/C19H29N3OS/c1-18(2,3)17-21-12-16(22-17)11-20-15-9-7-8-14(10-15)13-24(23)19(4,5)6/h7-10,12,20H,11,13H2,1-6H3,(H,21,22) |
| InChIKey | SURTZOXQPNWIAT-UHFFFAOYSA-N |
| XLogP | 4.37 |
| TPSA | 57.78 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 347.53 |
| LogP ≤ 5 | 4.37 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |