C16H26O2S2 — CID 139198160
1,4-bis[[(R)-tert-butylsulfinyl]methyl]benzene (PubChem CID 139198160) has the molecular formula C16H26O2S2 and a molecular weight of 314.52 g/mol. Its IUPAC name is 1,4-bis[[(R)-tert-butylsulfinyl]methyl]benzene.
| Compound Name | 1,4-bis[[(R)-tert-butylsulfinyl]methyl]benzene |
|---|---|
| PubChem CID | 139198160 |
| Molecular Formula | C16H26O2S2 |
| Molecular Weight | 314.52 g/mol |
| Exact Mass | 314.14 |
| IUPAC Name | 1,4-bis[[(R)-tert-butylsulfinyl]methyl]benzene |
| SMILES | CC(C)(C)[S@](=O)Cc1ccc(C[S@@](=O)C(C)(C)C)cc1 |
| InChI | InChI=1S/C16H26O2S2/c1-15(2,3)19(17)11-13-7-9-14(10-8-13)12-20(18)16(4,5)6/h7-10H,11-12H2,1-6H3/t19-,20-/m1/s1 |
| InChIKey | PQJSHSGLCJFTLF-WOJBJXKFSA-N |
| XLogP | 3.78 |
| TPSA | 34.14 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 314.52 |
| LogP ≤ 5 | 3.78 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |