C12H14N4O — CID 55262140
1-(3-methylphenyl)-3-(5-methyl-1H-pyrazol-3-yl)urea (PubChem CID 55262140) has the molecular formula C12H14N4O and a molecular weight of 230.27 g/mol. Its IUPAC name is 1-(3-methylphenyl)-3-(5-methyl-1H-pyrazol-3-yl)urea.
| Compound Name | 1-(3-methylphenyl)-3-(5-methyl-1H-pyrazol-3-yl)urea |
|---|---|
| PubChem CID | 55262140 |
| Molecular Formula | C12H14N4O |
| Molecular Weight | 230.27 g/mol |
| Exact Mass | 230.12 |
| IUPAC Name | 1-(3-methylphenyl)-3-(5-methyl-1H-pyrazol-3-yl)urea |
| SMILES | Cc1cccc(NC(=O)Nc2cc(C)[nH]n2)c1 |
| InChI | InChI=1S/C12H14N4O/c1-8-4-3-5-10(6-8)13-12(17)14-11-7-9(2)15-16-11/h3-7H,1-2H3,(H3,13,14,15,16,17) |
| InChIKey | XDHUCLGHMMPODP-UHFFFAOYSA-N |
| XLogP | 2.67 |
| TPSA | 69.81 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 230.27 |
| LogP ≤ 5 | 2.67 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 2 |