C15H14N6O — CID 99835736
1-(5-methyl-1H-pyrazol-3-yl)-3-(2-phenylpyrimidin-5-yl)urea (PubChem CID 99835736) has the molecular formula C15H14N6O and a molecular weight of 294.32 g/mol. Its IUPAC name is 1-(5-methyl-1H-pyrazol-3-yl)-3-(2-phenylpyrimidin-5-yl)urea.
| Compound Name | 1-(5-methyl-1H-pyrazol-3-yl)-3-(2-phenylpyrimidin-5-yl)urea |
|---|---|
| PubChem CID | 99835736 |
| Molecular Formula | C15H14N6O |
| Molecular Weight | 294.32 g/mol |
| Exact Mass | 294.12 |
| IUPAC Name | 1-(5-methyl-1H-pyrazol-3-yl)-3-(2-phenylpyrimidin-5-yl)urea |
| SMILES | Cc1cc(NC(=O)Nc2cnc(-c3ccccc3)nc2)n[nH]1 |
| InChI | InChI=1S/C15H14N6O/c1-10-7-13(21-20-10)19-15(22)18-12-8-16-14(17-9-12)11-5-3-2-4-6-11/h2-9H,1H3,(H3,18,19,20,21,22) |
| InChIKey | CPDWTZUUSRXFNA-UHFFFAOYSA-N |
| XLogP | 2.82 |
| TPSA | 95.59 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 294.32 |
| LogP ≤ 5 | 2.82 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |