C13H14N4O2 — CID 63820246
N-(4-methylphenyl)-N'-(5-methyl-1H-pyrazol-3-yl)oxamide (PubChem CID 63820246) has the molecular formula C13H14N4O2 and a molecular weight of 258.28 g/mol. Its IUPAC name is N-(4-methylphenyl)-N'-(5-methyl-1H-pyrazol-3-yl)oxamide.
| Compound Name | N-(4-methylphenyl)-N'-(5-methyl-1H-pyrazol-3-yl)oxamide |
|---|---|
| PubChem CID | 63820246 |
| Molecular Formula | C13H14N4O2 |
| Molecular Weight | 258.28 g/mol |
| Exact Mass | 258.11 |
| IUPAC Name | N-(4-methylphenyl)-N'-(5-methyl-1H-pyrazol-3-yl)oxamide |
| SMILES | Cc1ccc(NC(=O)C(=O)Nc2cc(C)[nH]n2)cc1 |
| InChI | InChI=1S/C13H14N4O2/c1-8-3-5-10(6-4-8)14-12(18)13(19)15-11-7-9(2)16-17-11/h3-7H,1-2H3,(H,14,18)(H2,15,16,17,19) |
| InChIKey | DDSLZQLULIGOQX-UHFFFAOYSA-N |
| XLogP | 1.60 |
| TPSA | 86.88 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 258.28 |
| LogP ≤ 5 | 1.60 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|