C20H23ClN2S — CID 100764935
1-[1-(2-chlorophenyl)cyclopentyl]-3-(2,5-dimethylphenyl)thiourea (PubChem CID 100764935) has the molecular formula C20H23ClN2S and a molecular weight of 358.94 g/mol. Its IUPAC name is 1-[1-(2-chlorophenyl)cyclopentyl]-3-(2,5-dimethylphenyl)thiourea.
| Compound Name | 1-[1-(2-chlorophenyl)cyclopentyl]-3-(2,5-dimethylphenyl)thiourea |
|---|---|
| PubChem CID | 100764935 |
| Molecular Formula | C20H23ClN2S |
| Molecular Weight | 358.94 g/mol |
| Exact Mass | 358.13 |
| IUPAC Name | 1-[1-(2-chlorophenyl)cyclopentyl]-3-(2,5-dimethylphenyl)thiourea |
| SMILES | Cc1ccc(C)c(NC(=S)NC2(c3ccccc3Cl)CCCC2)c1 |
| InChI | InChI=1S/C20H23ClN2S/c1-14-9-10-15(2)18(13-14)22-19(24)23-20(11-5-6-12-20)16-7-3-4-8-17(16)21/h3-4,7-10,13H,5-6,11-12H2,1-2H3,(H2,22,23,24) |
| InChIKey | KCQDUUWEQRZKIR-UHFFFAOYSA-N |
| XLogP | 5.71 |
| TPSA | 24.06 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 24 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 358.94 |
| LogP ≤ 5 | 5.71 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|