C17H26N2S — CID 100764876
1-(2,4-dimethylphenyl)-3-(1-propan-2-ylcyclopentyl)thiourea (PubChem CID 100764876) has the molecular formula C17H26N2S and a molecular weight of 290.48 g/mol. Its IUPAC name is 1-(2,4-dimethylphenyl)-3-(1-propan-2-ylcyclopentyl)thiourea.
| Compound Name | 1-(2,4-dimethylphenyl)-3-(1-propan-2-ylcyclopentyl)thiourea |
|---|---|
| PubChem CID | 100764876 |
| Molecular Formula | C17H26N2S |
| Molecular Weight | 290.48 g/mol |
| Exact Mass | 290.18 |
| IUPAC Name | 1-(2,4-dimethylphenyl)-3-(1-propan-2-ylcyclopentyl)thiourea |
| SMILES | Cc1ccc(NC(=S)NC2(C(C)C)CCCC2)c(C)c1 |
| InChI | InChI=1S/C17H26N2S/c1-12(2)17(9-5-6-10-17)19-16(20)18-15-8-7-13(3)11-14(15)4/h7-8,11-12H,5-6,9-10H2,1-4H3,(H2,18,19,20) |
| InChIKey | RMMOFHFILRKAFL-UHFFFAOYSA-N |
| XLogP | 4.56 |
| TPSA | 24.06 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 290.48 |
| LogP ≤ 5 | 4.56 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|