C15H22N2OS — CID 23932184
1-(2,4-dimethylphenyl)-3-(4-hydroxycyclohexyl)thiourea (PubChem CID 23932184) has the molecular formula C15H22N2OS and a molecular weight of 278.42 g/mol. Its IUPAC name is 1-(2,4-dimethylphenyl)-3-(4-hydroxycyclohexyl)thiourea.
| Compound Name | 1-(2,4-dimethylphenyl)-3-(4-hydroxycyclohexyl)thiourea |
|---|---|
| PubChem CID | 23932184 |
| Molecular Formula | C15H22N2OS |
| Molecular Weight | 278.42 g/mol |
| Exact Mass | 278.15 |
| IUPAC Name | 1-(2,4-dimethylphenyl)-3-(4-hydroxycyclohexyl)thiourea |
| SMILES | Cc1ccc(NC(=S)NC2CCC(O)CC2)c(C)c1 |
| InChI | InChI=1S/C15H22N2OS/c1-10-3-8-14(11(2)9-10)17-15(19)16-12-4-6-13(18)7-5-12/h3,8-9,12-13,18H,4-7H2,1-2H3,(H2,16,17,19) |
| InChIKey | HVMLWLTVNXJGJO-UHFFFAOYSA-N |
| XLogP | 2.89 |
| TPSA | 44.29 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 278.42 |
| LogP ≤ 5 | 2.89 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|