C21H27N3S — CID 100724977
1-(2,4-dimethylphenyl)-3-[(1R)-1-(4-pyrrolidin-1-ylphenyl)ethyl]thiourea (PubChem CID 100724977) has the molecular formula C21H27N3S and a molecular weight of 353.54 g/mol. Its IUPAC name is 1-(2,4-dimethylphenyl)-3-[(1R)-1-(4-pyrrolidin-1-ylphenyl)ethyl]thiourea.
| Compound Name | 1-(2,4-dimethylphenyl)-3-[(1R)-1-(4-pyrrolidin-1-ylphenyl)ethyl]thiourea |
|---|---|
| PubChem CID | 100724977 |
| Molecular Formula | C21H27N3S |
| Molecular Weight | 353.54 g/mol |
| Exact Mass | 353.19 |
| IUPAC Name | 1-(2,4-dimethylphenyl)-3-[(1R)-1-(4-pyrrolidin-1-ylphenyl)ethyl]thiourea |
| SMILES | Cc1ccc(NC(=S)N[C@H](C)c2ccc(N3CCCC3)cc2)c(C)c1 |
| InChI | InChI=1S/C21H27N3S/c1-15-6-11-20(16(2)14-15)23-21(25)22-17(3)18-7-9-19(10-8-18)24-12-4-5-13-24/h6-11,14,17H,4-5,12-13H2,1-3H3,(H2,22,23,25)/t17-/m1/s1 |
| InChIKey | QXZPWTIZJJDJSE-QGZVFWFLSA-N |
| XLogP | 4.95 |
| TPSA | 27.30 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 353.54 |
| LogP ≤ 5 | 4.95 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'anil_di_alk_E(186)', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|