C23H31N3S — CID 100712112
1-(2,5-dimethylphenyl)-3-[(1R)-1-[4-(4-methylpiperidin-1-yl)phenyl]ethyl]thiourea (PubChem CID 100712112) has the molecular formula C23H31N3S and a molecular weight of 381.59 g/mol. Its IUPAC name is 1-(2,5-dimethylphenyl)-3-[(1R)-1-[4-(4-methylpiperidin-1-yl)phenyl]ethyl]thiourea.
| Compound Name | 1-(2,5-dimethylphenyl)-3-[(1R)-1-[4-(4-methylpiperidin-1-yl)phenyl]ethyl]thiourea |
|---|---|
| PubChem CID | 100712112 |
| Molecular Formula | C23H31N3S |
| Molecular Weight | 381.59 g/mol |
| Exact Mass | 381.22 |
| IUPAC Name | 1-(2,5-dimethylphenyl)-3-[(1R)-1-[4-(4-methylpiperidin-1-yl)phenyl]ethyl]thiourea |
| SMILES | Cc1ccc(C)c(NC(=S)N[C@H](C)c2ccc(N3CCC(C)CC3)cc2)c1 |
| InChI | InChI=1S/C23H31N3S/c1-16-11-13-26(14-12-16)21-9-7-20(8-10-21)19(4)24-23(27)25-22-15-17(2)5-6-18(22)3/h5-10,15-16,19H,11-14H2,1-4H3,(H2,24,25,27)/t19-/m1/s1 |
| InChIKey | VDCJZEPGJHBPOQ-LJQANCHMSA-N |
| XLogP | 5.59 |
| TPSA | 27.30 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 381.59 |
| LogP ≤ 5 | 5.59 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'anil_di_alk_E(186)', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|