C19H22N2O3S — CID 100768414
methyl 3-[[1-(furan-2-yl)cyclopentyl]carbamothioylamino]-4-methylbenzoate (PubChem CID 100768414) has the molecular formula C19H22N2O3S and a molecular weight of 358.46 g/mol. Its IUPAC name is methyl 3-[[1-(furan-2-yl)cyclopentyl]carbamothioylamino]-4-methylbenzoate.
| Compound Name | methyl 3-[[1-(furan-2-yl)cyclopentyl]carbamothioylamino]-4-methylbenzoate |
|---|---|
| PubChem CID | 100768414 |
| Molecular Formula | C19H22N2O3S |
| Molecular Weight | 358.46 g/mol |
| Exact Mass | 358.14 |
| IUPAC Name | methyl 3-[[1-(furan-2-yl)cyclopentyl]carbamothioylamino]-4-methylbenzoate |
| SMILES | COC(=O)c1ccc(C)c(NC(=S)NC2(c3ccco3)CCCC2)c1 |
| InChI | InChI=1S/C19H22N2O3S/c1-13-7-8-14(17(22)23-2)12-15(13)20-18(25)21-19(9-3-4-10-19)16-6-5-11-24-16/h5-8,11-12H,3-4,9-10H2,1-2H3,(H2,20,21,25) |
| InChIKey | NTVPMJBQGUSUDP-UHFFFAOYSA-N |
| XLogP | 4.13 |
| TPSA | 63.50 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 358.46 |
| LogP ≤ 5 | 4.13 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|