C18H26N2O2S — CID 100768397
methyl 4-methyl-3-[(1-propan-2-ylcyclopentyl)carbamothioylamino]benzoate (PubChem CID 100768397) has the molecular formula C18H26N2O2S and a molecular weight of 334.49 g/mol. Its IUPAC name is methyl 4-methyl-3-[(1-propan-2-ylcyclopentyl)carbamothioylamino]benzoate.
| Compound Name | methyl 4-methyl-3-[(1-propan-2-ylcyclopentyl)carbamothioylamino]benzoate |
|---|---|
| PubChem CID | 100768397 |
| Molecular Formula | C18H26N2O2S |
| Molecular Weight | 334.49 g/mol |
| Exact Mass | 334.17 |
| IUPAC Name | methyl 4-methyl-3-[(1-propan-2-ylcyclopentyl)carbamothioylamino]benzoate |
| SMILES | COC(=O)c1ccc(C)c(NC(=S)NC2(C(C)C)CCCC2)c1 |
| InChI | InChI=1S/C18H26N2O2S/c1-12(2)18(9-5-6-10-18)20-17(23)19-15-11-14(16(21)22-4)8-7-13(15)3/h7-8,11-12H,5-6,9-10H2,1-4H3,(H2,19,20,23) |
| InChIKey | PFMKAOSYDFTBMK-UHFFFAOYSA-N |
| XLogP | 4.04 |
| TPSA | 50.36 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 334.49 |
| LogP ≤ 5 | 4.04 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|