C19H20ClFN2S — CID 100768468
1-(3-chloro-4-fluorophenyl)-3-[1-(4-methylphenyl)cyclopentyl]thiourea (PubChem CID 100768468) has the molecular formula C19H20ClFN2S and a molecular weight of 362.90 g/mol. Its IUPAC name is 1-(3-chloro-4-fluorophenyl)-3-[1-(4-methylphenyl)cyclopentyl]thiourea.
| Compound Name | 1-(3-chloro-4-fluorophenyl)-3-[1-(4-methylphenyl)cyclopentyl]thiourea |
|---|---|
| PubChem CID | 100768468 |
| Molecular Formula | C19H20ClFN2S |
| Molecular Weight | 362.90 g/mol |
| Exact Mass | 362.10 |
| IUPAC Name | 1-(3-chloro-4-fluorophenyl)-3-[1-(4-methylphenyl)cyclopentyl]thiourea |
| SMILES | Cc1ccc(C2(NC(=S)Nc3ccc(F)c(Cl)c3)CCCC2)cc1 |
| InChI | InChI=1S/C19H20ClFN2S/c1-13-4-6-14(7-5-13)19(10-2-3-11-19)23-18(24)22-15-8-9-17(21)16(20)12-15/h4-9,12H,2-3,10-11H2,1H3,(H2,22,23,24) |
| InChIKey | NNLDWAWFODJKCD-UHFFFAOYSA-N |
| XLogP | 5.54 |
| TPSA | 24.06 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 24 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 362.90 |
| LogP ≤ 5 | 5.54 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|