C19H23N3S — CID 100765080
1-(3,5-dimethylphenyl)-3-(1-pyridin-4-ylcyclopentyl)thiourea (PubChem CID 100765080) has the molecular formula C19H23N3S and a molecular weight of 325.48 g/mol. Its IUPAC name is 1-(3,5-dimethylphenyl)-3-(1-pyridin-4-ylcyclopentyl)thiourea.
| Compound Name | 1-(3,5-dimethylphenyl)-3-(1-pyridin-4-ylcyclopentyl)thiourea |
|---|---|
| PubChem CID | 100765080 |
| Molecular Formula | C19H23N3S |
| Molecular Weight | 325.48 g/mol |
| Exact Mass | 325.16 |
| IUPAC Name | 1-(3,5-dimethylphenyl)-3-(1-pyridin-4-ylcyclopentyl)thiourea |
| SMILES | Cc1cc(C)cc(NC(=S)NC2(c3ccncc3)CCCC2)c1 |
| InChI | InChI=1S/C19H23N3S/c1-14-11-15(2)13-17(12-14)21-18(23)22-19(7-3-4-8-19)16-5-9-20-10-6-16/h5-6,9-13H,3-4,7-8H2,1-2H3,(H2,21,22,23) |
| InChIKey | VNKNMMYQNFRKRQ-UHFFFAOYSA-N |
| XLogP | 4.45 |
| TPSA | 36.95 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 325.48 |
| LogP ≤ 5 | 4.45 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|