C18H21N3S — CID 100772383
1-[1-(3-methylphenyl)cyclopentyl]-3-pyridin-3-ylthiourea (PubChem CID 100772383) has the molecular formula C18H21N3S and a molecular weight of 311.45 g/mol. Its IUPAC name is 1-[1-(3-methylphenyl)cyclopentyl]-3-pyridin-3-ylthiourea.
| Compound Name | 1-[1-(3-methylphenyl)cyclopentyl]-3-pyridin-3-ylthiourea |
|---|---|
| PubChem CID | 100772383 |
| Molecular Formula | C18H21N3S |
| Molecular Weight | 311.45 g/mol |
| Exact Mass | 311.15 |
| IUPAC Name | 1-[1-(3-methylphenyl)cyclopentyl]-3-pyridin-3-ylthiourea |
| SMILES | Cc1cccc(C2(NC(=S)Nc3cccnc3)CCCC2)c1 |
| InChI | InChI=1S/C18H21N3S/c1-14-6-4-7-15(12-14)18(9-2-3-10-18)21-17(22)20-16-8-5-11-19-13-16/h4-8,11-13H,2-3,9-10H2,1H3,(H2,20,21,22) |
| InChIKey | ARWFJLBUZURXQY-UHFFFAOYSA-N |
| XLogP | 4.15 |
| TPSA | 36.95 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 311.45 |
| LogP ≤ 5 | 4.15 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|