C17H17F2N3S — CID 100769368
1-(2,6-difluorophenyl)-3-(1-pyridin-3-ylcyclopentyl)thiourea (PubChem CID 100769368) has the molecular formula C17H17F2N3S and a molecular weight of 333.41 g/mol. Its IUPAC name is 1-(2,6-difluorophenyl)-3-(1-pyridin-3-ylcyclopentyl)thiourea.
| Compound Name | 1-(2,6-difluorophenyl)-3-(1-pyridin-3-ylcyclopentyl)thiourea |
|---|---|
| PubChem CID | 100769368 |
| Molecular Formula | C17H17F2N3S |
| Molecular Weight | 333.41 g/mol |
| Exact Mass | 333.11 |
| IUPAC Name | 1-(2,6-difluorophenyl)-3-(1-pyridin-3-ylcyclopentyl)thiourea |
| SMILES | Fc1cccc(F)c1NC(=S)NC1(c2cccnc2)CCCC1 |
| InChI | InChI=1S/C17H17F2N3S/c18-13-6-3-7-14(19)15(13)21-16(23)22-17(8-1-2-9-17)12-5-4-10-20-11-12/h3-7,10-11H,1-2,8-9H2,(H2,21,22,23) |
| InChIKey | OKZSRCAPNJPWTR-UHFFFAOYSA-N |
| XLogP | 4.12 |
| TPSA | 36.95 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 333.41 |
| LogP ≤ 5 | 4.12 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|