C20H18F6N2S — CID 100766675
1-[3-(trifluoromethyl)phenyl]-3-[1-[3-(trifluoromethyl)phenyl]cyclopentyl]thiourea (PubChem CID 100766675) has the molecular formula C20H18F6N2S and a molecular weight of 432.43 g/mol. Its IUPAC name is 1-[3-(trifluoromethyl)phenyl]-3-[1-[3-(trifluoromethyl)phenyl]cyclopentyl]thiourea.
| Compound Name | 1-[3-(trifluoromethyl)phenyl]-3-[1-[3-(trifluoromethyl)phenyl]cyclopentyl]thiourea |
|---|---|
| PubChem CID | 100766675 |
| Molecular Formula | C20H18F6N2S |
| Molecular Weight | 432.43 g/mol |
| Exact Mass | 432.11 |
| IUPAC Name | 1-[3-(trifluoromethyl)phenyl]-3-[1-[3-(trifluoromethyl)phenyl]cyclopentyl]thiourea |
| SMILES | FC(F)(F)c1cccc(NC(=S)NC2(c3cccc(C(F)(F)F)c3)CCCC2)c1 |
| InChI | InChI=1S/C20H18F6N2S/c21-19(22,23)14-6-3-5-13(11-14)18(9-1-2-10-18)28-17(29)27-16-8-4-7-15(12-16)20(24,25)26/h3-8,11-12H,1-2,9-10H2,(H2,27,28,29) |
| InChIKey | MQOAYNBOLANKNF-UHFFFAOYSA-N |
| XLogP | 6.48 |
| TPSA | 24.06 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 432.43 |
| LogP ≤ 5 | 6.48 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|