C19H20F3N3S — CID 100771973
1-(3-methyl-2-pyridinyl)-3-[1-[3-(trifluoromethyl)phenyl]cyclopentyl]thiourea (PubChem CID 100771973) has the molecular formula C19H20F3N3S and a molecular weight of 379.45 g/mol. Its IUPAC name is 1-(3-methyl-2-pyridinyl)-3-[1-[3-(trifluoromethyl)phenyl]cyclopentyl]thiourea.
| Compound Name | 1-(3-methyl-2-pyridinyl)-3-[1-[3-(trifluoromethyl)phenyl]cyclopentyl]thiourea |
|---|---|
| PubChem CID | 100771973 |
| Molecular Formula | C19H20F3N3S |
| Molecular Weight | 379.45 g/mol |
| Exact Mass | 379.13 |
| IUPAC Name | 1-(3-methyl-2-pyridinyl)-3-[1-[3-(trifluoromethyl)phenyl]cyclopentyl]thiourea |
| SMILES | Cc1cccnc1NC(=S)NC1(c2cccc(C(F)(F)F)c2)CCCC1 |
| InChI | InChI=1S/C19H20F3N3S/c1-13-6-5-11-23-16(13)24-17(26)25-18(9-2-3-10-18)14-7-4-8-15(12-14)19(20,21)22/h4-8,11-12H,2-3,9-10H2,1H3,(H2,23,24,25,26) |
| InChIKey | HOWWRFWWAQESQH-UHFFFAOYSA-N |
| XLogP | 5.16 |
| TPSA | 36.95 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 379.45 |
| LogP ≤ 5 | 5.16 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|