C15H11F6N3S — CID 127097884
1-[3,5-bis(trifluoromethyl)phenyl]-3-(3-methyl-2-pyridinyl)thiourea (PubChem CID 127097884) has the molecular formula C15H11F6N3S and a molecular weight of 379.33 g/mol. Its IUPAC name is 1-[3,5-bis(trifluoromethyl)phenyl]-3-(3-methyl-2-pyridinyl)thiourea.
| Compound Name | 1-[3,5-bis(trifluoromethyl)phenyl]-3-(3-methyl-2-pyridinyl)thiourea |
|---|---|
| PubChem CID | 127097884 |
| Molecular Formula | C15H11F6N3S |
| Molecular Weight | 379.33 g/mol |
| Exact Mass | 379.06 |
| IUPAC Name | 1-[3,5-bis(trifluoromethyl)phenyl]-3-(3-methyl-2-pyridinyl)thiourea |
| SMILES | Cc1cccnc1NC(=S)Nc1cc(C(F)(F)F)cc(C(F)(F)F)c1 |
| InChI | InChI=1S/C15H11F6N3S/c1-8-3-2-4-22-12(8)24-13(25)23-11-6-9(14(16,17)18)5-10(7-11)15(19,20)21/h2-7H,1H3,(H2,22,23,24,25) |
| InChIKey | QCHLMHNBRSKYPH-UHFFFAOYSA-N |
| XLogP | 5.24 |
| TPSA | 36.95 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 25 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 379.33 |
| LogP ≤ 5 | 5.24 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|