C15H17N3O2S — CID 19685989
1-(3,5-dimethoxyphenyl)-3-(3-methyl-2-pyridinyl)thiourea (PubChem CID 19685989) has the molecular formula C15H17N3O2S and a molecular weight of 303.39 g/mol. Its IUPAC name is 1-(3,5-dimethoxyphenyl)-3-(3-methyl-2-pyridinyl)thiourea.
| Compound Name | 1-(3,5-dimethoxyphenyl)-3-(3-methyl-2-pyridinyl)thiourea |
|---|---|
| PubChem CID | 19685989 |
| Molecular Formula | C15H17N3O2S |
| Molecular Weight | 303.39 g/mol |
| Exact Mass | 303.10 |
| IUPAC Name | 1-(3,5-dimethoxyphenyl)-3-(3-methyl-2-pyridinyl)thiourea |
| SMILES | COc1cc(NC(=S)Nc2ncccc2C)cc(OC)c1 |
| InChI | InChI=1S/C15H17N3O2S/c1-10-5-4-6-16-14(10)18-15(21)17-11-7-12(19-2)9-13(8-11)20-3/h4-9H,1-3H3,(H2,16,17,18,21) |
| InChIKey | ZHQXZGCYMFGALA-UHFFFAOYSA-N |
| XLogP | 3.22 |
| TPSA | 55.41 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 303.39 |
| LogP ≤ 5 | 3.22 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|