C17H21N3OS — CID 100707457
1-[(2R)-1-(2-methylphenoxy)propan-2-yl]-3-(3-methyl-2-pyridinyl)thiourea (PubChem CID 100707457) has the molecular formula C17H21N3OS and a molecular weight of 315.44 g/mol. Its IUPAC name is 1-[(2R)-1-(2-methylphenoxy)propan-2-yl]-3-(3-methyl-2-pyridinyl)thiourea.
| Compound Name | 1-[(2R)-1-(2-methylphenoxy)propan-2-yl]-3-(3-methyl-2-pyridinyl)thiourea |
|---|---|
| PubChem CID | 100707457 |
| Molecular Formula | C17H21N3OS |
| Molecular Weight | 315.44 g/mol |
| Exact Mass | 315.14 |
| IUPAC Name | 1-[(2R)-1-(2-methylphenoxy)propan-2-yl]-3-(3-methyl-2-pyridinyl)thiourea |
| SMILES | Cc1ccccc1OC[C@@H](C)NC(=S)Nc1ncccc1C |
| InChI | InChI=1S/C17H21N3OS/c1-12-7-4-5-9-15(12)21-11-14(3)19-17(22)20-16-13(2)8-6-10-18-16/h4-10,14H,11H2,1-3H3,(H2,18,19,20,22)/t14-/m1/s1 |
| InChIKey | PBRGWEIQSOLCKL-CQSZACIVSA-N |
| XLogP | 3.45 |
| TPSA | 46.18 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 315.44 |
| LogP ≤ 5 | 3.45 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|