C18H23N3O2S — CID 133230923
1-[1-(3,4-dimethylphenoxy)propan-2-yl]-3-(3-methoxy-2-pyridinyl)thiourea (PubChem CID 133230923) has the molecular formula C18H23N3O2S and a molecular weight of 345.47 g/mol. Its IUPAC name is 1-[1-(3,4-dimethylphenoxy)propan-2-yl]-3-(3-methoxy-2-pyridinyl)thiourea.
| Compound Name | 1-[1-(3,4-dimethylphenoxy)propan-2-yl]-3-(3-methoxy-2-pyridinyl)thiourea |
|---|---|
| PubChem CID | 133230923 |
| Molecular Formula | C18H23N3O2S |
| Molecular Weight | 345.47 g/mol |
| Exact Mass | 345.15 |
| IUPAC Name | 1-[1-(3,4-dimethylphenoxy)propan-2-yl]-3-(3-methoxy-2-pyridinyl)thiourea |
| SMILES | COc1cccnc1NC(=S)NC(C)COc1ccc(C)c(C)c1 |
| InChI | InChI=1S/C18H23N3O2S/c1-12-7-8-15(10-13(12)2)23-11-14(3)20-18(24)21-17-16(22-4)6-5-9-19-17/h5-10,14H,11H2,1-4H3,(H2,19,20,21,24) |
| InChIKey | TXFVFQLEEOWQLX-UHFFFAOYSA-N |
| XLogP | 3.46 |
| TPSA | 55.41 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 345.47 |
| LogP ≤ 5 | 3.46 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|