C18H20F2N2OS — CID 100752508
1-(2,4-difluorophenyl)-3-[(2S)-1-(3,4-dimethylphenoxy)propan-2-yl]thiourea (PubChem CID 100752508) has the molecular formula C18H20F2N2OS and a molecular weight of 350.43 g/mol. Its IUPAC name is 1-(2,4-difluorophenyl)-3-[(2S)-1-(3,4-dimethylphenoxy)propan-2-yl]thiourea.
| Compound Name | 1-(2,4-difluorophenyl)-3-[(2S)-1-(3,4-dimethylphenoxy)propan-2-yl]thiourea |
|---|---|
| PubChem CID | 100752508 |
| Molecular Formula | C18H20F2N2OS |
| Molecular Weight | 350.43 g/mol |
| Exact Mass | 350.13 |
| IUPAC Name | 1-(2,4-difluorophenyl)-3-[(2S)-1-(3,4-dimethylphenoxy)propan-2-yl]thiourea |
| SMILES | Cc1ccc(OC[C@H](C)NC(=S)Nc2ccc(F)cc2F)cc1C |
| InChI | InChI=1S/C18H20F2N2OS/c1-11-4-6-15(8-12(11)2)23-10-13(3)21-18(24)22-17-7-5-14(19)9-16(17)20/h4-9,13H,10H2,1-3H3,(H2,21,22,24)/t13-/m0/s1 |
| InChIKey | ZMRZIGOCKZAEDM-ZDUSSCGKSA-N |
| XLogP | 4.34 |
| TPSA | 33.29 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 350.43 |
| LogP ≤ 5 | 4.34 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|