C22H28N2O3S — CID 100752691
ethyl 3-[[(2R)-1-(3,4-dimethylphenoxy)propan-2-yl]carbamothioylamino]-4-methylbenzoate (PubChem CID 100752691) has the molecular formula C22H28N2O3S and a molecular weight of 400.54 g/mol. Its IUPAC name is ethyl 3-[[(2R)-1-(3,4-dimethylphenoxy)propan-2-yl]carbamothioylamino]-4-methylbenzoate.
| Compound Name | ethyl 3-[[(2R)-1-(3,4-dimethylphenoxy)propan-2-yl]carbamothioylamino]-4-methylbenzoate |
|---|---|
| PubChem CID | 100752691 |
| Molecular Formula | C22H28N2O3S |
| Molecular Weight | 400.54 g/mol |
| Exact Mass | 400.18 |
| IUPAC Name | ethyl 3-[[(2R)-1-(3,4-dimethylphenoxy)propan-2-yl]carbamothioylamino]-4-methylbenzoate |
| SMILES | CCOC(=O)c1ccc(C)c(NC(=S)N[C@H](C)COc2ccc(C)c(C)c2)c1 |
| InChI | InChI=1S/C22H28N2O3S/c1-6-26-21(25)18-9-7-15(3)20(12-18)24-22(28)23-17(5)13-27-19-10-8-14(2)16(4)11-19/h7-12,17H,6,13H2,1-5H3,(H2,23,24,28)/t17-/m1/s1 |
| InChIKey | SIRNOPAVWOISJY-QGZVFWFLSA-N |
| XLogP | 4.54 |
| TPSA | 59.59 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 400.54 |
| LogP ≤ 5 | 4.54 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|