C21H27N3O2S — CID 100752898
4-[[(2R)-1-(3,4-dimethylphenoxy)propan-2-yl]carbamothioylamino]-N,N-dimethylbenzamide (PubChem CID 100752898) has the molecular formula C21H27N3O2S and a molecular weight of 385.53 g/mol. Its IUPAC name is 4-[[(2R)-1-(3,4-dimethylphenoxy)propan-2-yl]carbamothioylamino]-N,N-dimethylbenzamide.
| Compound Name | 4-[[(2R)-1-(3,4-dimethylphenoxy)propan-2-yl]carbamothioylamino]-N,N-dimethylbenzamide |
|---|---|
| PubChem CID | 100752898 |
| Molecular Formula | C21H27N3O2S |
| Molecular Weight | 385.53 g/mol |
| Exact Mass | 385.18 |
| IUPAC Name | 4-[[(2R)-1-(3,4-dimethylphenoxy)propan-2-yl]carbamothioylamino]-N,N-dimethylbenzamide |
| SMILES | Cc1ccc(OC[C@@H](C)NC(=S)Nc2ccc(C(=O)N(C)C)cc2)cc1C |
| InChI | InChI=1S/C21H27N3O2S/c1-14-6-11-19(12-15(14)2)26-13-16(3)22-21(27)23-18-9-7-17(8-10-18)20(25)24(4)5/h6-12,16H,13H2,1-5H3,(H2,22,23,27)/t16-/m1/s1 |
| InChIKey | JLBJRXHWLHTDTR-MRXNPFEDSA-N |
| XLogP | 3.76 |
| TPSA | 53.60 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 385.53 |
| LogP ≤ 5 | 3.76 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|