C21H26N2O2S — CID 133215847
ethyl 4-methyl-3-(4-phenylbutan-2-ylcarbamothioylamino)benzoate (PubChem CID 133215847) has the molecular formula C21H26N2O2S and a molecular weight of 370.52 g/mol. Its IUPAC name is ethyl 4-methyl-3-(4-phenylbutan-2-ylcarbamothioylamino)benzoate.
| Compound Name | ethyl 4-methyl-3-(4-phenylbutan-2-ylcarbamothioylamino)benzoate |
|---|---|
| PubChem CID | 133215847 |
| Molecular Formula | C21H26N2O2S |
| Molecular Weight | 370.52 g/mol |
| Exact Mass | 370.17 |
| IUPAC Name | ethyl 4-methyl-3-(4-phenylbutan-2-ylcarbamothioylamino)benzoate |
| SMILES | CCOC(=O)c1ccc(C)c(NC(=S)NC(C)CCc2ccccc2)c1 |
| InChI | InChI=1S/C21H26N2O2S/c1-4-25-20(24)18-13-10-15(2)19(14-18)23-21(26)22-16(3)11-12-17-8-6-5-7-9-17/h5-10,13-14,16H,4,11-12H2,1-3H3,(H2,22,23,26) |
| InChIKey | DJQOMPLIYOGSCG-UHFFFAOYSA-N |
| XLogP | 4.48 |
| TPSA | 50.36 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 370.52 |
| LogP ≤ 5 | 4.48 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|