C14H20F2N2S — CID 19650931
1-(2,4-difluorophenyl)-3-heptan-2-ylthiourea (PubChem CID 19650931) has the molecular formula C14H20F2N2S and a molecular weight of 286.39 g/mol. Its IUPAC name is 1-(2,4-difluorophenyl)-3-heptan-2-ylthiourea.
| Compound Name | 1-(2,4-difluorophenyl)-3-heptan-2-ylthiourea |
|---|---|
| PubChem CID | 19650931 |
| Molecular Formula | C14H20F2N2S |
| Molecular Weight | 286.39 g/mol |
| Exact Mass | 286.13 |
| IUPAC Name | 1-(2,4-difluorophenyl)-3-heptan-2-ylthiourea |
| SMILES | CCCCCC(C)NC(=S)Nc1ccc(F)cc1F |
| InChI | InChI=1S/C14H20F2N2S/c1-3-4-5-6-10(2)17-14(19)18-13-8-7-11(15)9-12(13)16/h7-10H,3-6H2,1-2H3,(H2,17,18,19) |
| InChIKey | OCRIHDPWUMTDLD-UHFFFAOYSA-N |
| XLogP | 4.22 |
| TPSA | 24.06 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 286.39 |
| LogP ≤ 5 | 4.22 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|