C15H13F3N2S — CID 92512962
1-(2,4-difluorophenyl)-3-[(1S)-1-(4-fluorophenyl)ethyl]thiourea (PubChem CID 92512962) has the molecular formula C15H13F3N2S and a molecular weight of 310.34 g/mol. Its IUPAC name is 1-(2,4-difluorophenyl)-3-[(1S)-1-(4-fluorophenyl)ethyl]thiourea.
| Compound Name | 1-(2,4-difluorophenyl)-3-[(1S)-1-(4-fluorophenyl)ethyl]thiourea |
|---|---|
| PubChem CID | 92512962 |
| Molecular Formula | C15H13F3N2S |
| Molecular Weight | 310.34 g/mol |
| Exact Mass | 310.08 |
| IUPAC Name | 1-(2,4-difluorophenyl)-3-[(1S)-1-(4-fluorophenyl)ethyl]thiourea |
| SMILES | C[C@H](NC(=S)Nc1ccc(F)cc1F)c1ccc(F)cc1 |
| InChI | InChI=1S/C15H13F3N2S/c1-9(10-2-4-11(16)5-3-10)19-15(21)20-14-7-6-12(17)8-13(14)18/h2-9H,1H3,(H2,19,20,21)/t9-/m0/s1 |
| InChIKey | XWSVWPIJNYJYFB-VIFPVBQESA-N |
| XLogP | 4.15 |
| TPSA | 24.06 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 310.34 |
| LogP ≤ 5 | 4.15 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|