C19H25N3OS — CID 100714699
1-(3-methoxy-2-pyridinyl)-3-[(2S)-4-methyl-4-phenylpentan-2-yl]thiourea (PubChem CID 100714699) has the molecular formula C19H25N3OS and a molecular weight of 343.50 g/mol. Its IUPAC name is 1-(3-methoxy-2-pyridinyl)-3-[(2S)-4-methyl-4-phenylpentan-2-yl]thiourea.
| Compound Name | 1-(3-methoxy-2-pyridinyl)-3-[(2S)-4-methyl-4-phenylpentan-2-yl]thiourea |
|---|---|
| PubChem CID | 100714699 |
| Molecular Formula | C19H25N3OS |
| Molecular Weight | 343.50 g/mol |
| Exact Mass | 343.17 |
| IUPAC Name | 1-(3-methoxy-2-pyridinyl)-3-[(2S)-4-methyl-4-phenylpentan-2-yl]thiourea |
| SMILES | COc1cccnc1NC(=S)N[C@@H](C)CC(C)(C)c1ccccc1 |
| InChI | InChI=1S/C19H25N3OS/c1-14(13-19(2,3)15-9-6-5-7-10-15)21-18(24)22-17-16(23-4)11-8-12-20-17/h5-12,14H,13H2,1-4H3,(H2,20,21,22,24)/t14-/m0/s1 |
| InChIKey | HMZQEFIXTFPMID-AWEZNQCLSA-N |
| XLogP | 4.13 |
| TPSA | 46.18 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 343.50 |
| LogP ≤ 5 | 4.13 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|