C22H27N3OS — CID 100771371
1-(4-cyclopentyloxyphenyl)-3-(1-pyridin-3-ylcyclopentyl)thiourea (PubChem CID 100771371) has the molecular formula C22H27N3OS and a molecular weight of 381.55 g/mol. Its IUPAC name is 1-(4-cyclopentyloxyphenyl)-3-(1-pyridin-3-ylcyclopentyl)thiourea.
| Compound Name | 1-(4-cyclopentyloxyphenyl)-3-(1-pyridin-3-ylcyclopentyl)thiourea |
|---|---|
| PubChem CID | 100771371 |
| Molecular Formula | C22H27N3OS |
| Molecular Weight | 381.55 g/mol |
| Exact Mass | 381.19 |
| IUPAC Name | 1-(4-cyclopentyloxyphenyl)-3-(1-pyridin-3-ylcyclopentyl)thiourea |
| SMILES | S=C(Nc1ccc(OC2CCCC2)cc1)NC1(c2cccnc2)CCCC1 |
| InChI | InChI=1S/C22H27N3OS/c27-21(25-22(13-3-4-14-22)17-6-5-15-23-16-17)24-18-9-11-20(12-10-18)26-19-7-1-2-8-19/h5-6,9-12,15-16,19H,1-4,7-8,13-14H2,(H2,24,25,27) |
| InChIKey | BFWBBQDSIFZRFB-UHFFFAOYSA-N |
| XLogP | 5.16 |
| TPSA | 46.18 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 381.55 |
| LogP ≤ 5 | 5.16 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|