About 3-cycloheptyloxypyridine
3-cycloheptyloxypyridine (PubChem CID 112558615) has the molecular formula C12H17NO
and a molecular weight of 191.27 g/mol. Its IUPAC name is 3-cycloheptyloxypyridine.
Molecular Properties
| Compound Name | 3-cycloheptyloxypyridine |
| PubChem CID | 112558615 |
| Molecular Formula | C12H17NO |
| Molecular Weight | 191.27 g/mol |
| Exact Mass | 191.13 |
| IUPAC Name | 3-cycloheptyloxypyridine |
| SMILES | c1cncc(OC2CCCCCC2)c1 |
| InChI | InChI=1S/C12H17NO/c1-2-4-7-11(6-3-1)14-12-8-5-9-13-10-12/h5,8-11H,1-4,6-7H2 |
| InChIKey | ZIIVQPJDTYTMLK-UHFFFAOYSA-N |
| XLogP | 3.18 |
| TPSA | 22.12 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 191.27 |
| LogP ≤ 5 | 3.18 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 3-cycloheptyloxypyridine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-cycloheptyloxypyridine?
The IUPAC name of 3-cycloheptyloxypyridine (CID 112558615) is 3-cycloheptyloxypyridine.
What is the SMILES notation for 3-cycloheptyloxypyridine?
The canonical SMILES for 3-cycloheptyloxypyridine is c1cncc(OC2CCCCCC2)c1.
What is the InChIKey of 3-cycloheptyloxypyridine?
The InChIKey is ZIIVQPJDTYTMLK-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H17NO/c1-2-4-7-11(6-3-1)14-12-8-5-9-13-10-12/h5,8-11H,1-4,6-7H2.
What are the key properties of 3-cycloheptyloxypyridine?
3-cycloheptyloxypyridine has a molecular weight of 191.27 g/mol, XLogP of 3.18, 2 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 3-cycloheptyloxypyridine is sourced from PubChem (CID 112558615), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).