C19H21ClN2OS — CID 100765643
1-(4-chlorophenyl)-3-[1-(4-methoxyphenyl)cyclopentyl]thiourea (PubChem CID 100765643) has the molecular formula C19H21ClN2OS and a molecular weight of 360.91 g/mol. Its IUPAC name is 1-(4-chlorophenyl)-3-[1-(4-methoxyphenyl)cyclopentyl]thiourea.
| Compound Name | 1-(4-chlorophenyl)-3-[1-(4-methoxyphenyl)cyclopentyl]thiourea |
|---|---|
| PubChem CID | 100765643 |
| Molecular Formula | C19H21ClN2OS |
| Molecular Weight | 360.91 g/mol |
| Exact Mass | 360.11 |
| IUPAC Name | 1-(4-chlorophenyl)-3-[1-(4-methoxyphenyl)cyclopentyl]thiourea |
| SMILES | COc1ccc(C2(NC(=S)Nc3ccc(Cl)cc3)CCCC2)cc1 |
| InChI | InChI=1S/C19H21ClN2OS/c1-23-17-10-4-14(5-11-17)19(12-2-3-13-19)22-18(24)21-16-8-6-15(20)7-9-16/h4-11H,2-3,12-13H2,1H3,(H2,21,22,24) |
| InChIKey | KOCZMJFOFVYHBK-UHFFFAOYSA-N |
| XLogP | 5.10 |
| TPSA | 33.29 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 360.91 |
| LogP ≤ 5 | 5.10 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|