C14H14ClN3OS — CID 8619679
1-(4-chloroanilino)-3-(4-methoxyphenyl)thiourea (PubChem CID 8619679) has the molecular formula C14H14ClN3OS and a molecular weight of 307.81 g/mol. Its IUPAC name is 1-(4-chloroanilino)-3-(4-methoxyphenyl)thiourea.
| Compound Name | 1-(4-chloroanilino)-3-(4-methoxyphenyl)thiourea |
|---|---|
| PubChem CID | 8619679 |
| Molecular Formula | C14H14ClN3OS |
| Molecular Weight | 307.81 g/mol |
| Exact Mass | 307.05 |
| IUPAC Name | 1-(4-chloroanilino)-3-(4-methoxyphenyl)thiourea |
| SMILES | COc1ccc(NC(=S)NNc2ccc(Cl)cc2)cc1 |
| InChI | InChI=1S/C14H14ClN3OS/c1-19-13-8-6-11(7-9-13)16-14(20)18-17-12-4-2-10(15)3-5-12/h2-9,17H,1H3,(H2,16,18,20) |
| InChIKey | WHRGKLWLNBWKGM-UHFFFAOYSA-N |
| XLogP | 3.66 |
| TPSA | 45.32 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 307.81 |
| LogP ≤ 5 | 3.66 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'thio_urea_D(8)', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|