C19H21BrN2S — CID 100765878
1-(4-bromophenyl)-3-[1-(3-methylphenyl)cyclopentyl]thiourea (PubChem CID 100765878) has the molecular formula C19H21BrN2S and a molecular weight of 389.36 g/mol. Its IUPAC name is 1-(4-bromophenyl)-3-[1-(3-methylphenyl)cyclopentyl]thiourea.
| Compound Name | 1-(4-bromophenyl)-3-[1-(3-methylphenyl)cyclopentyl]thiourea |
|---|---|
| PubChem CID | 100765878 |
| Molecular Formula | C19H21BrN2S |
| Molecular Weight | 389.36 g/mol |
| Exact Mass | 388.06 |
| IUPAC Name | 1-(4-bromophenyl)-3-[1-(3-methylphenyl)cyclopentyl]thiourea |
| SMILES | Cc1cccc(C2(NC(=S)Nc3ccc(Br)cc3)CCCC2)c1 |
| InChI | InChI=1S/C19H21BrN2S/c1-14-5-4-6-15(13-14)19(11-2-3-12-19)22-18(23)21-17-9-7-16(20)8-10-17/h4-10,13H,2-3,11-12H2,1H3,(H2,21,22,23) |
| InChIKey | IDIBZAHLFQPWMH-UHFFFAOYSA-N |
| XLogP | 5.51 |
| TPSA | 24.06 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 23 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 389.36 |
| LogP ≤ 5 | 5.51 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|