C24H25N3S2 — CID 100768255
1-[4-(phenylsulfanylmethyl)phenyl]-3-(1-pyridin-4-ylcyclopentyl)thiourea (PubChem CID 100768255) has the molecular formula C24H25N3S2 and a molecular weight of 419.62 g/mol. Its IUPAC name is 1-[4-(phenylsulfanylmethyl)phenyl]-3-(1-pyridin-4-ylcyclopentyl)thiourea.
| Compound Name | 1-[4-(phenylsulfanylmethyl)phenyl]-3-(1-pyridin-4-ylcyclopentyl)thiourea |
|---|---|
| PubChem CID | 100768255 |
| Molecular Formula | C24H25N3S2 |
| Molecular Weight | 419.62 g/mol |
| Exact Mass | 419.15 |
| IUPAC Name | 1-[4-(phenylsulfanylmethyl)phenyl]-3-(1-pyridin-4-ylcyclopentyl)thiourea |
| SMILES | S=C(Nc1ccc(CSc2ccccc2)cc1)NC1(c2ccncc2)CCCC1 |
| InChI | InChI=1S/C24H25N3S2/c28-23(27-24(14-4-5-15-24)20-12-16-25-17-13-20)26-21-10-8-19(9-11-21)18-29-22-6-2-1-3-7-22/h1-3,6-13,16-17H,4-5,14-15,18H2,(H2,26,27,28) |
| InChIKey | VNYBTGVFZQVWBP-UHFFFAOYSA-N |
| XLogP | 6.13 |
| TPSA | 36.95 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 419.62 |
| LogP ≤ 5 | 6.13 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|