C20H22F2N2O2S — CID 100769470
1-(3,4-difluorophenyl)-3-[1-(3,4-dimethoxyphenyl)cyclopentyl]thiourea (PubChem CID 100769470) has the molecular formula C20H22F2N2O2S and a molecular weight of 392.47 g/mol. Its IUPAC name is 1-(3,4-difluorophenyl)-3-[1-(3,4-dimethoxyphenyl)cyclopentyl]thiourea.
| Compound Name | 1-(3,4-difluorophenyl)-3-[1-(3,4-dimethoxyphenyl)cyclopentyl]thiourea |
|---|---|
| PubChem CID | 100769470 |
| Molecular Formula | C20H22F2N2O2S |
| Molecular Weight | 392.47 g/mol |
| Exact Mass | 392.14 |
| IUPAC Name | 1-(3,4-difluorophenyl)-3-[1-(3,4-dimethoxyphenyl)cyclopentyl]thiourea |
| SMILES | COc1ccc(C2(NC(=S)Nc3ccc(F)c(F)c3)CCCC2)cc1OC |
| InChI | InChI=1S/C20H22F2N2O2S/c1-25-17-8-5-13(11-18(17)26-2)20(9-3-4-10-20)24-19(27)23-14-6-7-15(21)16(22)12-14/h5-8,11-12H,3-4,9-10H2,1-2H3,(H2,23,24,27) |
| InChIKey | NZIKPNSKPIVPHZ-UHFFFAOYSA-N |
| XLogP | 4.74 |
| TPSA | 42.52 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 392.47 |
| LogP ≤ 5 | 4.74 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|